Labguru · Schema

CompoundBaseRequest

Electronic Lab NotebookELNLIMSLaboratory Information ManagementBiotechLife SciencesResearch Data ManagementInventory ManagementExperiment ManagementREST APIGraphQL

Properties

Name Type Description
token string
smiles string
item object
View JSON Schema on GitHub

JSON Schema

CompoundBaseRequest.json Raw ↑ 
{
  "$schema": "http://json-schema.org/draft-07/schema#",
  "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/CompoundBaseRequest.json",
  "title": "CompoundBaseRequest",
  "type": "object",
  "required": [
    "token"
  ],
  "properties": {
    "token": {
      "type": "string",
      "example": "YOUR TOKEN IS HERE"
    },
    "smiles": {
      "type": "string",
      "example": "C(=O)N1CCC(CCCC(=O)c2ccc(Cl)n(Cc3ncc(o3)-c3ccc(Cl)cc3)c2=O)CC1"
    },
    "item": {
      "type": "object",
      "properties": {
        "name": {
          "type": "string",
          "description": "The name of the compound"
        },
        "description": {
          "type": "string",
          "description": "Updated description of the compound"
        },
        "structure": {
          "type": "string",
          "description": "Compound structure",
          "example": "C(=O)N1CCC(CCCC(=O)c2ccc(Cl)n(Cc3ncc(o3)-c3ccc(Cl)cc3)c2=O)CC1"
        },
        "cas": {
          "type": "string",
          "description": "Compound CAS"
        },
        "formula": {
          "type": "string",
          "description": "Compound formula"
        },
        "molar_mass": {
          "type": "string",
          "description": "Compound molar mass"
        },
        "density": {
          "type": "string",
          "description": "Compound density"
        },
        "boiling_point": {
          "type": "string",
          "description": "Compound boiling point"
        },
        "melting_point": {
          "type": "string",
          "description": "Compound melting point"
        },
        "hazards": {
          "type": "string",
          "description": "Compound hazards"
        }
      }
    }
  }
}